C17H26N4O3 — CID 97477177
2-[[(3aS,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide (PubChem CID 97477177) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aS,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97477177 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-[[(3aS,6aS)-2-(6-methoxypyrimidin-4-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide |
| SMILES | COc1cc(N2C[C@H]3CCC[C@@]3(COCC(=O)N(C)C)C2)ncn1 |
| InChI | InChI=1S/C17H26N4O3/c1-20(2)16(22)9-24-11-17-6-4-5-13(17)8-21(10-17)14-7-15(23-3)19-12-18-14/h7,12-13H,4-6,8-11H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | XUIJQJFVZNUWNL-DYVFJYSZSA-N |
| XLogP | 1.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |