C18H25N5O2 — CID 97477267
(1S,3aR,7aR)-5-[(2-methoxy-3-pyridinyl)methyl]-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 97477267) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (1S,3aR,7aR)-5-[(2-methoxy-3-pyridinyl)methyl]-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | (1S,3aR,7aR)-5-[(2-methoxy-3-pyridinyl)methyl]-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97477267 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (1S,3aR,7aR)-5-[(2-methoxy-3-pyridinyl)methyl]-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | COc1ncccc1CN1CC[C@@H]2[C@@H](CO[C@H]2Cc2n[nH]c(C)n2)C1 |
| InChI | InChI=1S/C18H25N5O2/c1-12-20-17(22-21-12)8-16-15-5-7-23(10-14(15)11-25-16)9-13-4-3-6-19-18(13)24-2/h3-4,6,14-16H,5,7-11H2,1-2H3,(H,20,21,22)/t14-,15-,16+/m1/s1 |
| InChIKey | WFTAGMIIKPHIJU-OAGGEKHMSA-N |
| XLogP | 1.60 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |