C16H21N5O3 — CID 97477744
[(3S,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone (PubChem CID 97477744) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone.
| Compound Name | [(3S,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97477744 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [(3S,3aS,6aS)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone |
| SMILES | CCn1nc(C)cc1C(=O)N1C[C@H]2[C@@H](C1)OC[C@H]2c1nc(C)no1 |
| InChI | InChI=1S/C16H21N5O3/c1-4-21-13(5-9(2)18-21)16(22)20-6-11-12(8-23-14(11)7-20)15-17-10(3)19-24-15/h5,11-12,14H,4,6-8H2,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | MJDCBXQTYPZYOG-YRGRVCCFSA-N |
| XLogP | 1.16 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |