C16H19FN4OS — CID 97477903
(1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 97477903) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97477903 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (1S,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | Cc1csc(C[C@@H]2OC[C@H]3CN(c4ncc(F)cn4)CC[C@H]32)n1 |
| InChI | InChI=1S/C16H19FN4OS/c1-10-9-23-15(20-10)4-14-13-2-3-21(7-11(13)8-22-14)16-18-5-12(17)6-19-16/h5-6,9,11,13-14H,2-4,7-8H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | LXJLTWRCGGQMOB-BNOWGMLFSA-N |
| XLogP | 2.46 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |