C18H27NO2 — CID 97482240
(3S,4R)-3-benzyl-4-(oxan-4-ylmethoxy)piperidine (PubChem CID 97482240) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (3S,4R)-3-benzyl-4-(oxan-4-ylmethoxy)piperidine.
| Compound Name | (3S,4R)-3-benzyl-4-(oxan-4-ylmethoxy)piperidine |
|---|---|
| PubChem CID | 97482240 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (3S,4R)-3-benzyl-4-(oxan-4-ylmethoxy)piperidine |
| SMILES | c1ccc(C[C@H]2CNCC[C@H]2OCC2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-2-4-15(5-3-1)12-17-13-19-9-6-18(17)21-14-16-7-10-20-11-8-16/h1-5,16-19H,6-14H2/t17-,18+/m0/s1 |
| InChIKey | MVBRYTHNQYRNQP-ZWKOTPCHSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |