C20H28N2O2 — CID 97482941
(5S)-2,9-bis[(5-methylfuran-2-yl)methyl]-2,9-diazaspiro[4.5]decane (PubChem CID 97482941) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (5S)-2,9-bis[(5-methylfuran-2-yl)methyl]-2,9-diazaspiro[4.5]decane.
| Compound Name | (5S)-2,9-bis[(5-methylfuran-2-yl)methyl]-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97482941 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (5S)-2,9-bis[(5-methylfuran-2-yl)methyl]-2,9-diazaspiro[4.5]decane |
| SMILES | Cc1ccc(CN2CCC[C@@]3(CCN(Cc4ccc(C)o4)C3)C2)o1 |
| InChI | InChI=1S/C20H28N2O2/c1-16-4-6-18(23-16)12-21-10-3-8-20(14-21)9-11-22(15-20)13-19-7-5-17(2)24-19/h4-7H,3,8-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | SCYCQSCMSOPXBO-HXUWFJFHSA-N |
| XLogP | 3.98 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |