C17H22FNO2 — CID 97483068
(3R,3aS,6aS)-5-cyclobutyl-3-[(2-fluorophenoxy)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97483068) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-cyclobutyl-3-[(2-fluorophenoxy)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3R,3aS,6aS)-5-cyclobutyl-3-[(2-fluorophenoxy)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97483068 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3R,3aS,6aS)-5-cyclobutyl-3-[(2-fluorophenoxy)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Fc1ccccc1OC[C@H]1CO[C@@H]2CN(C3CCC3)C[C@H]12 |
| InChI | InChI=1S/C17H22FNO2/c18-15-6-1-2-7-16(15)20-10-12-11-21-17-9-19(8-14(12)17)13-4-3-5-13/h1-2,6-7,12-14,17H,3-5,8-11H2/t12-,14+,17+/m0/s1 |
| InChIKey | VDJSBZCHQGGJBN-DXCKQFNASA-N |
| XLogP | 2.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |