C14H26N2O — CID 97484526
1-[(3aR,6aR)-5-cyclopentyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine (PubChem CID 97484526) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-cyclopentyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3aR,6aR)-5-cyclopentyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97484526 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-[(3aR,6aR)-5-cyclopentyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@]12COC[C@H]1CN(C1CCCC1)C2 |
| InChI | InChI=1S/C14H26N2O/c1-15(2)9-14-10-16(13-5-3-4-6-13)7-12(14)8-17-11-14/h12-13H,3-11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | NIKSBNPOQHBXIL-OCCSQVGLSA-N |
| XLogP | 1.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |