C17H24N6O — CID 97484662
(3S)-4-[(1-methylpyrazol-4-yl)methyl]-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholine (PubChem CID 97484662) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is (3S)-4-[(1-methylpyrazol-4-yl)methyl]-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholine.
| Compound Name | (3S)-4-[(1-methylpyrazol-4-yl)methyl]-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholine |
|---|---|
| PubChem CID | 97484662 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (3S)-4-[(1-methylpyrazol-4-yl)methyl]-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)morpholine |
| SMILES | Cn1cc(CN2CCOC[C@@H]2c2nccc(N3CCCC3)n2)cn1 |
| InChI | InChI=1S/C17H24N6O/c1-21-11-14(10-19-21)12-23-8-9-24-13-15(23)17-18-5-4-16(20-17)22-6-2-3-7-22/h4-5,10-11,15H,2-3,6-9,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | XMOOPSFLDQCJQZ-OAHLLOKOSA-N |
| XLogP | 1.38 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |