C17H26N2O3S — CID 97485285
1-[(1S,3aR,7aR)-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-ethoxyethanone (PubChem CID 97485285) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[(1S,3aR,7aR)-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[(1S,3aR,7aR)-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 97485285 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(1S,3aR,7aR)-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CC[C@@H]2[C@@H](CO[C@H]2Cc2nc(C)c(C)s2)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-4-21-10-17(20)19-6-5-14-13(8-19)9-22-15(14)7-16-18-11(2)12(3)23-16/h13-15H,4-10H2,1-3H3/t13-,14-,15+/m1/s1 |
| InChIKey | ZAHAMVZZADJHBK-KFWWJZLASA-N |
| XLogP | 2.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |