C16H20N6O2 — CID 97486069
(3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide (PubChem CID 97486069) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide.
| Compound Name | (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 97486069 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
| SMILES | Cn1cc(CN2C[C@@H]3[C@@H](C(=O)Nc4cnccn4)CO[C@@H]3C2)cn1 |
| InChI | InChI=1S/C16H20N6O2/c1-21-6-11(4-19-21)7-22-8-12-13(10-24-14(12)9-22)16(23)20-15-5-17-2-3-18-15/h2-6,12-14H,7-10H2,1H3,(H,18,20,23)/t12-,13+,14-/m1/s1 |
| InChIKey | WPWAXNZGEWBAFL-HZSPNIEDSA-N |
| XLogP | 0.30 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |