C18H31NO3 — CID 97487114
cyclohexyl-[(3S)-3-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 97487114) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is cyclohexyl-[(3S)-3-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | cyclohexyl-[(3S)-3-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 97487114 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | cyclohexyl-[(3S)-3-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | COCC[C@@H]1COC2(CCN(C(=O)C3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C18H31NO3/c1-21-12-7-15-13-18(22-14-15)8-10-19(11-9-18)17(20)16-5-3-2-4-6-16/h15-16H,2-14H2,1H3/t15-/m0/s1 |
| InChIKey | BXSVKKGVTBCQAK-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |