C29H22N2O5 — CID 97488146
(10R)-10-[2-(dimethylamino)quinolin-3-yl]-5-hydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97488146) has the molecular formula C29H22N2O5 and a molecular weight of 478.50 g/mol. Its IUPAC name is (10R)-10-[2-(dimethylamino)quinolin-3-yl]-5-hydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-10-[2-(dimethylamino)quinolin-3-yl]-5-hydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488146 |
| Molecular Formula | C29H22N2O5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (10R)-10-[2-(dimethylamino)quinolin-3-yl]-5-hydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CN(C)c1nc2ccccc2cc1[C@H]1CC(=O)Oc2cc(O)c3c(=O)cc(-c4ccccc4)oc3c21 |
| InChI | InChI=1S/C29H22N2O5/c1-31(2)29-19(12-17-10-6-7-11-20(17)30-29)18-13-25(34)35-24-15-22(33)27-21(32)14-23(36-28(27)26(18)24)16-8-4-3-5-9-16/h3-12,14-15,18,33H,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | BUNHYUCSPJFINW-GOSISDBHSA-N |
| XLogP | 5.22 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|