C24H20N2O8 — CID 97488278
(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-propan-2-ylpyrazol-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97488278) has the molecular formula C24H20N2O8 and a molecular weight of 464.43 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-propan-2-ylpyrazol-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-propan-2-ylpyrazol-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488278 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-propan-2-ylpyrazol-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CC(C)n1nccc1[C@@H]1CC(=O)Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c21 |
| InChI | InChI=1S/C24H20N2O8/c1-10(2)26-13(5-6-25-26)12-8-18(30)33-17-9-16(29)20-21(31)22(32)23(34-24(20)19(12)17)11-3-4-14(27)15(28)7-11/h3-7,9-10,12,27-29,32H,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | NXVYZUMNFNZRBN-LBPRGKRZSA-N |
| XLogP | 3.50 |
| TPSA | 155.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|