C24H14ClFO8 — CID 97488660
(10R)-10-(3-chloro-2-fluorophenyl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97488660) has the molecular formula C24H14ClFO8 and a molecular weight of 484.82 g/mol. Its IUPAC name is (10R)-10-(3-chloro-2-fluorophenyl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-10-(3-chloro-2-fluorophenyl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488660 |
| Molecular Formula | C24H14ClFO8 |
| Molecular Weight | 484.82 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | (10R)-10-(3-chloro-2-fluorophenyl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2cccc(Cl)c2F)c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C24H14ClFO8/c25-12-3-1-2-10(20(12)26)11-7-17(30)33-16-8-15(29)19-21(31)22(32)23(34-24(19)18(11)16)9-4-5-13(27)14(28)6-9/h1-6,8,11,27-29,32H,7H2/t11-/m0/s1 |
| InChIKey | SFPQIPVOTZKAFM-NSHDSACASA-N |
| XLogP | 4.52 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|