About 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile
4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile (PubChem CID 97491858) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile |
| PubChem CID | 97491858 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile |
| SMILES | CN1CCOCC12CCN(c1ccc(C#N)cc1)CC2 |
| InChI | InChI=1S/C16H21N3O/c1-18-10-11-20-13-16(18)6-8-19(9-7-16)15-4-2-14(12-17)3-5-15/h2-5H,6-11,13H2,1H3 |
| InChIKey | WOHQCMABHPUXMD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile?
The IUPAC name of 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile (CID 97491858) is 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile.
What is the SMILES notation for 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile?
The canonical SMILES for 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile is CN1CCOCC12CCN(c1ccc(C#N)cc1)CC2.
What is the InChIKey of 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile?
The InChIKey is WOHQCMABHPUXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-18-10-11-20-13-16(18)6-8-19(9-7-16)15-4-2-14(12-17)3-5-15/h2-5H,6-11,13H2,1H3.
What are the key properties of 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile?
4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile has a molecular weight of 271.36 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methyl-4-oxa-1,9-diazaspiro[5.5]undecan-9-yl)benzonitrile is sourced from PubChem (CID 97491858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).