C20H22N4O2 — CID 97492570
(2S,3R)-5-N-benzyl-2-N-pyridin-3-yl-5-azaspiro[2.4]heptane-2,5-dicarboxamide (PubChem CID 97492570) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S,3R)-5-N-benzyl-2-N-pyridin-3-yl-5-azaspiro[2.4]heptane-2,5-dicarboxamide.
| Compound Name | (2S,3R)-5-N-benzyl-2-N-pyridin-3-yl-5-azaspiro[2.4]heptane-2,5-dicarboxamide |
|---|---|
| PubChem CID | 97492570 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2S,3R)-5-N-benzyl-2-N-pyridin-3-yl-5-azaspiro[2.4]heptane-2,5-dicarboxamide |
| SMILES | O=C(Nc1cccnc1)[C@H]1C[C@@]12CCN(C(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C20H22N4O2/c25-18(23-16-7-4-9-21-13-16)17-11-20(17)8-10-24(14-20)19(26)22-12-15-5-2-1-3-6-15/h1-7,9,13,17H,8,10-12,14H2,(H,22,26)(H,23,25)/t17-,20-/m1/s1 |
| InChIKey | DUSRAFHKGPFTIA-YLJYHZDGSA-N |
| XLogP | 2.64 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |