C16H21N3O2 — CID 97493701
1-ethyl-8-(pyridine-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97493701) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-ethyl-8-(pyridine-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-ethyl-8-(pyridine-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97493701 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-ethyl-8-(pyridine-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCN1C(=O)CCC12CCN(C(=O)c1cccnc1)CC2 |
| InChI | InChI=1S/C16H21N3O2/c1-2-19-14(20)5-6-16(19)7-10-18(11-8-16)15(21)13-4-3-9-17-12-13/h3-4,9,12H,2,5-8,10-11H2,1H3 |
| InChIKey | HTFZEKSAQSOBTL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |