C21H29N3O2 — CID 97494267
1-benzyl-3-[1-(cyclopropylmethyl)-2-oxo-1-azaspiro[4.5]decan-8-yl]urea (PubChem CID 97494267) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-benzyl-3-[1-(cyclopropylmethyl)-2-oxo-1-azaspiro[4.5]decan-8-yl]urea.
| Compound Name | 1-benzyl-3-[1-(cyclopropylmethyl)-2-oxo-1-azaspiro[4.5]decan-8-yl]urea |
|---|---|
| PubChem CID | 97494267 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-benzyl-3-[1-(cyclopropylmethyl)-2-oxo-1-azaspiro[4.5]decan-8-yl]urea |
| SMILES | O=C(NCc1ccccc1)NC1CCC2(CCC(=O)N2CC2CC2)CC1 |
| InChI | InChI=1S/C21H29N3O2/c25-19-10-13-21(24(19)15-17-6-7-17)11-8-18(9-12-21)23-20(26)22-14-16-4-2-1-3-5-16/h1-5,17-18H,6-15H2,(H2,22,23,26) |
| InChIKey | NRVPGDSBQBWMDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |