About (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane
(6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane (PubChem CID 97494891) has the molecular formula C17H27N3O2S
and a molecular weight of 337.49 g/mol. Its IUPAC name is (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane |
| PubChem CID | 97494891 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane |
| SMILES | c1csc(N2CCOC[C@@]3(CCCN(C4CCOCC4)C3)C2)n1 |
| InChI | InChI=1S/C17H27N3O2S/c1-4-17(12-19(6-1)15-2-8-21-9-3-15)13-20(7-10-22-14-17)16-18-5-11-23-16/h5,11,15H,1-4,6-10,12-14H2/t17-/m1/s1 |
| InChIKey | JOXBAUSLQOBHSW-QGZVFWFLSA-N |
| XLogP | 2.24 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane?
The IUPAC name of (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane (CID 97494891) is (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane?
The canonical SMILES for (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane is c1csc(N2CCOC[C@@]3(CCCN(C4CCOCC4)C3)C2)n1.
What is the InChIKey of (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane?
The InChIKey is JOXBAUSLQOBHSW-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H27N3O2S/c1-4-17(12-19(6-1)15-2-8-21-9-3-15)13-20(7-10-22-14-17)16-18-5-11-23-16/h5,11,15H,1-4,6-10,12-14H2/t17-/m1/s1.
What are the key properties of (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane?
(6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane has a molecular weight of 337.49 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-(oxan-4-yl)-11-(1,3-thiazol-2-yl)-8-oxa-2,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 97494891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).