C17H26N2O2S — CID 97495057
(6S)-4-[(5-methylthiophen-2-yl)methyl]-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (PubChem CID 97495057) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is (6S)-4-[(5-methylthiophen-2-yl)methyl]-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
| Compound Name | (6S)-4-[(5-methylthiophen-2-yl)methyl]-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 97495057 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (6S)-4-[(5-methylthiophen-2-yl)methyl]-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| SMILES | C=CCN1CCOC[C@]2(C1)CN(Cc1ccc(C)s1)CCO2 |
| InChI | InChI=1S/C17H26N2O2S/c1-3-6-18-7-9-20-14-17(12-18)13-19(8-10-21-17)11-16-5-4-15(2)22-16/h3-5H,1,6-14H2,2H3/t17-/m0/s1 |
| InChIKey | OZTLEZGEHIAXMZ-KRWDZBQOSA-N |
| XLogP | 2.15 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|