C21H24FN3O3S — CID 97495869
1-benzyl-9-(4-fluorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecan-5-one (PubChem CID 97495869) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-benzyl-9-(4-fluorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecan-5-one.
| Compound Name | 1-benzyl-9-(4-fluorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 97495869 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-benzyl-9-(4-fluorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecan-5-one |
| SMILES | O=C1NCCN(Cc2ccccc2)C12CCN(S(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H24FN3O3S/c22-18-6-8-19(9-7-18)29(27,28)25-13-10-21(11-14-25)20(26)23-12-15-24(21)16-17-4-2-1-3-5-17/h1-9H,10-16H2,(H,23,26) |
| InChIKey | PDDRZBNCXQQJTB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |