C13H10ClFN4O2S2 — CID 97496812
(3R)-3-[3-(3-chloro-2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide (PubChem CID 97496812) has the molecular formula C13H10ClFN4O2S2 and a molecular weight of 372.83 g/mol. Its IUPAC name is (3R)-3-[3-(3-chloro-2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[3-(3-chloro-2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 97496812 |
| Molecular Formula | C13H10ClFN4O2S2 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | (3R)-3-[3-(3-chloro-2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](c2nn3c(-c4cccc(Cl)c4F)nnc3s2)C1 |
| InChI | InChI=1S/C13H10ClFN4O2S2/c14-9-3-1-2-8(10(9)15)11-16-17-13-19(11)18-12(22-13)7-4-5-23(20,21)6-7/h1-3,7H,4-6H2/t7-/m1/s1 |
| InChIKey | JDBUOKUJWWFRAI-SSDOTTSWSA-N |
| XLogP | 2.55 |
| TPSA | 77.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |