C12H17BrN2O — CID 975030
N-(3-bromophenyl)-2-(diethylamino)acetamide (PubChem CID 975030) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(diethylamino)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 975030 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(3-bromophenyl)-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrN2O/c1-3-15(4-2)9-12(16)14-11-7-5-6-10(13)8-11/h5-8H,3-4,9H2,1-2H3,(H,14,16) |
| InChIKey | JZWCNTHRWJJOLI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |