C12H14N2S — CID 975322
4,6-dimethyl-2-(2-methylprop-2-enylsulfanyl)pyridine-3-carbonitrile (PubChem CID 975322) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 4,6-dimethyl-2-(2-methylprop-2-enylsulfanyl)pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-(2-methylprop-2-enylsulfanyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 975322 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4,6-dimethyl-2-(2-methylprop-2-enylsulfanyl)pyridine-3-carbonitrile |
| SMILES | C=C(C)CSc1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C12H14N2S/c1-8(2)7-15-12-11(6-13)9(3)5-10(4)14-12/h5H,1,7H2,2-4H3 |
| InChIKey | CVNUZBVVCBNRCL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|