C14H13N3O3S — CID 975599
2-(1-methylimidazol-2-yl)sulfanyl-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide (PubChem CID 975599) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)sulfanyl-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide.
| Compound Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide |
|---|---|
| PubChem CID | 975599 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide |
| SMILES | Cn1ccnc1SCC(=O)Nc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C14H13N3O3S/c1-17-5-4-15-14(17)21-8-12(18)16-10-2-3-11-9(6-10)7-20-13(11)19/h2-6H,7-8H2,1H3,(H,16,18) |
| InChIKey | DCAJGYFTQKWZBC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |