About 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile (PubChem CID 975846) has the molecular formula C11H10N2S2
and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
| PubChem CID | 975846 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1ccccc1CSC1=NCCS1 |
| InChI | InChI=1S/C11H10N2S2/c12-7-9-3-1-2-4-10(9)8-15-11-13-5-6-14-11/h1-4H,5-6,8H2 |
| InChIKey | CYFHXJPQXDGLAS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile?
The IUPAC name of 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile (CID 975846) is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile.
What is the SMILES notation for 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile?
The canonical SMILES for 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile is N#Cc1ccccc1CSC1=NCCS1.
What is the InChIKey of 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile?
The InChIKey is CYFHXJPQXDGLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S2/c12-7-9-3-1-2-4-10(9)8-15-11-13-5-6-14-11/h1-4H,5-6,8H2.
What are the key properties of 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile?
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile has a molecular weight of 234.35 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzonitrile is sourced from PubChem (CID 975846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).