C15H19N3O — CID 976045
1-[2-(2,4-dimethyl-6-prop-2-enylphenoxy)ethyl]-1,2,4-triazole (PubChem CID 976045) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-6-prop-2-enylphenoxy)ethyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-dimethyl-6-prop-2-enylphenoxy)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 976045 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[2-(2,4-dimethyl-6-prop-2-enylphenoxy)ethyl]-1,2,4-triazole |
| SMILES | C=CCc1cc(C)cc(C)c1OCCn1cncn1 |
| InChI | InChI=1S/C15H19N3O/c1-4-5-14-9-12(2)8-13(3)15(14)19-7-6-18-11-16-10-17-18/h4,8-11H,1,5-7H2,2-3H3 |
| InChIKey | BUHCPLHZSRYIBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|