About 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one
4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one (PubChem CID 97617924) has the molecular formula C6H6F2N2O
and a molecular weight of 160.12 g/mol. Its IUPAC name is 4-amino-1-(difluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one |
| PubChem CID | 97617924 |
| Molecular Formula | C6H6F2N2O |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4-amino-1-(difluoromethyl)pyridin-2-one |
| SMILES | C1=CN(C(=O)C=C1N)C(F)F |
| InChI | InChI=1S/C6H6F2N2O/c7-6(8)10-2-1-4(9)3-5(10)11/h1-3,6H,9H2 |
| InChIKey | MLROLQMSAHRFGA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 235 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one?
The IUPAC name of 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one (CID 97617924) is 4-amino-1-(difluoromethyl)pyridin-2-one.
What is the SMILES notation for 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one?
The canonical SMILES for 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one is C1=CN(C(=O)C=C1N)C(F)F.
What is the InChIKey of 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one?
The InChIKey is MLROLQMSAHRFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O/c7-6(8)10-2-1-4(9)3-5(10)11/h1-3,6H,9H2.
What are the key properties of 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one?
4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one has a molecular weight of 160.12 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Amino-1-(difluoromethyl)-1,2-dihydropyridin-2-one is sourced from PubChem (CID 97617924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).