About naphthalen-2-ylmethyl furan-2-carboxylate
naphthalen-2-ylmethyl furan-2-carboxylate (PubChem CID 976219) has the molecular formula C16H12O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is naphthalen-2-ylmethyl furan-2-carboxylate.
Molecular Properties
| Compound Name | naphthalen-2-ylmethyl furan-2-carboxylate |
| PubChem CID | 976219 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | naphthalen-2-ylmethyl furan-2-carboxylate |
| SMILES | O=C(OCc1ccc2ccccc2c1)c1ccco1 |
| InChI | InChI=1S/C16H12O3/c17-16(15-6-3-9-18-15)19-11-12-7-8-13-4-1-2-5-14(13)10-12/h1-10H,11H2 |
| InChIKey | QGZYHNIXKVYLOJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-2-ylmethyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylmethyl furan-2-carboxylate?
The IUPAC name of naphthalen-2-ylmethyl furan-2-carboxylate (CID 976219) is naphthalen-2-ylmethyl furan-2-carboxylate.
What is the SMILES notation for naphthalen-2-ylmethyl furan-2-carboxylate?
The canonical SMILES for naphthalen-2-ylmethyl furan-2-carboxylate is O=C(OCc1ccc2ccccc2c1)c1ccco1.
What is the InChIKey of naphthalen-2-ylmethyl furan-2-carboxylate?
The InChIKey is QGZYHNIXKVYLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O3/c17-16(15-6-3-9-18-15)19-11-12-7-8-13-4-1-2-5-14(13)10-12/h1-10H,11H2.
What are the key properties of naphthalen-2-ylmethyl furan-2-carboxylate?
naphthalen-2-ylmethyl furan-2-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylmethyl furan-2-carboxylate is sourced from PubChem (CID 976219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).