About 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine
4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 976569) has the molecular formula C9H15N5O2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| PubChem CID | 976569 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H15N5O2/c1-10-7-11-8(13-9(12-7)15-2)14-3-5-16-6-4-14/h3-6H2,1-2H3,(H,10,11,12,13) |
| InChIKey | QPAQBUPBMYEQDS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine?
The IUPAC name of 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine (CID 976569) is 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine is CNc1nc(OC)nc(N2CCOCC2)n1.
What is the InChIKey of 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine?
The InChIKey is QPAQBUPBMYEQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c1-10-7-11-8(13-9(12-7)15-2)14-3-5-16-6-4-14/h3-6H2,1-2H3,(H,10,11,12,13).
What are the key properties of 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine?
4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine has a molecular weight of 225.25 g/mol, XLogP of -0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-methyl-6-morpholin-4-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 976569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).