About 5'-Deoxy-5'-fluorothymidine
5'-Deoxy-5'-fluorothymidine (PubChem CID 97675) has the molecular formula C10H13FN2O4
and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-(fluoromethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5'-Deoxy-5'-fluorothymidine |
| PubChem CID | 97675 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-[(2R,4S,5S)-5-(fluoromethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CF)O |
| InChI | InChI=1S/C10H13FN2O4/c1-5-4-13(10(16)12-9(5)15)8-2-6(14)7(3-11)17-8/h4,6-8,14H,2-3H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
| InChIKey | MYWVPKQWFIVGJZ-XLPZGREQSA-N |
| XLogP | -0.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 385 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5'-Deoxy-5'-fluorothymidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-Deoxy-5'-fluorothymidine?
The IUPAC name of 5'-Deoxy-5'-fluorothymidine (CID 97675) is 1-[(2R,4S,5S)-5-(fluoromethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
What is the SMILES notation for 5'-Deoxy-5'-fluorothymidine?
The canonical SMILES for 5'-Deoxy-5'-fluorothymidine is CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CF)O.
What is the InChIKey of 5'-Deoxy-5'-fluorothymidine?
The InChIKey is MYWVPKQWFIVGJZ-XLPZGREQSA-N. The full InChI is InChI=1S/C10H13FN2O4/c1-5-4-13(10(16)12-9(5)15)8-2-6(14)7(3-11)17-8/h4,6-8,14H,2-3H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1.
What are the key properties of 5'-Deoxy-5'-fluorothymidine?
5'-Deoxy-5'-fluorothymidine has a molecular weight of 244.22 g/mol, XLogP of -0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-Deoxy-5'-fluorothymidine is sourced from PubChem (CID 97675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).