About (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate
(4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate (PubChem CID 977157) has the molecular formula C13H16ClNO3
and a molecular weight of 269.73 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate |
| PubChem CID | 977157 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate |
| SMILES | Cc1cc(OC(=O)N2CCOCC2)cc(C)c1Cl |
| InChI | InChI=1S/C13H16ClNO3/c1-9-7-11(8-10(2)12(9)14)18-13(16)15-3-5-17-6-4-15/h7-8H,3-6H2,1-2H3 |
| InChIKey | HOCAVOXOZWZNRN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate?
The IUPAC name of (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate (CID 977157) is (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate.
What is the SMILES notation for (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate?
The canonical SMILES for (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate is Cc1cc(OC(=O)N2CCOCC2)cc(C)c1Cl.
What is the InChIKey of (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate?
The InChIKey is HOCAVOXOZWZNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO3/c1-9-7-11(8-10(2)12(9)14)18-13(16)15-3-5-17-6-4-15/h7-8H,3-6H2,1-2H3.
What are the key properties of (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate?
(4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate has a molecular weight of 269.73 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3,5-dimethylphenyl) morpholine-4-carboxylate is sourced from PubChem (CID 977157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).