About 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone
2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone (PubChem CID 977526) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone |
| PubChem CID | 977526 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C15H19NO3/c1-11-4-6-16(7-5-11)15(17)12-2-3-13-14(10-12)19-9-8-18-13/h2-3,10-11H,4-9H2,1H3 |
| InChIKey | YQGFBFRGFZFRHZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone?
The IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone (CID 977526) is 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone is CC1CCN(C(=O)c2ccc3c(c2)OCCO3)CC1.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone?
The InChIKey is YQGFBFRGFZFRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-11-4-6-16(7-5-11)15(17)12-2-3-13-14(10-12)19-9-8-18-13/h2-3,10-11H,4-9H2,1H3.
What are the key properties of 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone?
2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone has a molecular weight of 261.32 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxin-6-yl-(4-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 977526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).