About 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone
2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 977576) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| PubChem CID | 977576 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(CS(=O)(=O)Cc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H19NO3S/c20-18(14-23(21,22)13-15-7-2-1-3-8-15)19-12-6-10-16-9-4-5-11-17(16)19/h1-5,7-9,11H,6,10,12-14H2 |
| InChIKey | OPLHFJDOCURBEV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone?
The IUPAC name of 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (CID 977576) is 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
What is the SMILES notation for 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone?
The canonical SMILES for 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone is O=C(CS(=O)(=O)Cc1ccccc1)N1CCCc2ccccc21.
What is the InChIKey of 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone?
The InChIKey is OPLHFJDOCURBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c20-18(14-23(21,22)13-15-7-2-1-3-8-15)19-12-6-10-16-9-4-5-11-17(16)19/h1-5,7-9,11H,6,10,12-14H2.
What are the key properties of 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone?
2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone has a molecular weight of 329.42 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone is sourced from PubChem (CID 977576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).