C18H10N2O4 — CID 977616
(1,3-dioxobenzo[de]isoquinolin-2-yl) pyridine-3-carboxylate (PubChem CID 977616) has the molecular formula C18H10N2O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) pyridine-3-carboxylate.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) pyridine-3-carboxylate |
|---|---|
| PubChem CID | 977616 |
| Molecular Formula | C18H10N2O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) pyridine-3-carboxylate |
| SMILES | O=C(ON1C(=O)c2cccc3cccc(c23)C1=O)c1cccnc1 |
| InChI | InChI=1S/C18H10N2O4/c21-16-13-7-1-4-11-5-2-8-14(15(11)13)17(22)20(16)24-18(23)12-6-3-9-19-10-12/h1-10H |
| InChIKey | OVCQMPLKPZAHFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|