2,2,3,3,4,4,4-heptafluorobutanoic acid

C4HF7O2 — CID 9777

IUPAC2,2,3,3,4,4,4-heptafluorobutanoic acid
SMILESO=C(O)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13)
InChIKeyYPJUNDFVDDCYIH-UHFFFAOYSA-N
MW214.04 g/mol
LogP1.90
Rot. Bonds2

About 2,2,3,3,4,4,4-heptafluorobutanoic acid

2,2,3,3,4,4,4-heptafluorobutanoic acid (PubChem CID 9777) has the molecular formula C4HF7O2 and a molecular weight of 214.04 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanoic acid.

Molecular Properties

Compound Name2,2,3,3,4,4,4-heptafluorobutanoic acid
PubChem CID9777
Molecular FormulaC4HF7O2
Molecular Weight214.04 g/mol
Exact Mass213.99
IUPAC Name2,2,3,3,4,4,4-heptafluorobutanoic acid
SMILESO=C(O)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13)
InChIKeyYPJUNDFVDDCYIH-UHFFFAOYSA-N
XLogP1.90
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.04
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2,2,3,3,4,4,4-heptafluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4,4,4-heptafluorobutanoic acid?
The IUPAC name of 2,2,3,3,4,4,4-heptafluorobutanoic acid (CID 9777) is 2,2,3,3,4,4,4-heptafluorobutanoic acid.
What is the SMILES notation for 2,2,3,3,4,4,4-heptafluorobutanoic acid?
The canonical SMILES for 2,2,3,3,4,4,4-heptafluorobutanoic acid is O=C(O)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of 2,2,3,3,4,4,4-heptafluorobutanoic acid?
The InChIKey is YPJUNDFVDDCYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13).
What are the key properties of 2,2,3,3,4,4,4-heptafluorobutanoic acid?
2,2,3,3,4,4,4-heptafluorobutanoic acid has a molecular weight of 214.04 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4,4,4-heptafluorobutanoic acid is sourced from PubChem (CID 9777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).