C18H12N4O2S — CID 977701
(3S)-3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,4-dihydroisochromen-1-one (PubChem CID 977701) has the molecular formula C18H12N4O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is (3S)-3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,4-dihydroisochromen-1-one.
| Compound Name | (3S)-3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 977701 |
| Molecular Formula | C18H12N4O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (3S)-3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1O[C@H](c2nn3c(-c4ccccc4)nnc3s2)Cc2ccccc21 |
| InChI | InChI=1S/C18H12N4O2S/c23-17-13-9-5-4-8-12(13)10-14(24-17)16-21-22-15(19-20-18(22)25-16)11-6-2-1-3-7-11/h1-9,14H,10H2/t14-/m0/s1 |
| InChIKey | QNENVQOENWIKMQ-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |