C11H13NO3 — CID 977765
(9S)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-9-ol (PubChem CID 977765) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (9S)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-9-ol.
| Compound Name | (9S)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-9-ol |
|---|---|
| PubChem CID | 977765 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (9S)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-9-ol |
| SMILES | O[C@@H]1CNCc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C11H13NO3/c13-9-6-12-5-7-3-10-11(4-8(7)9)15-2-1-14-10/h3-4,9,12-13H,1-2,5-6H2/t9-/m1/s1 |
| InChIKey | WVJYDTDWGIPKIU-SECBINFHSA-N |
| XLogP | 0.59 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |