C7HF15 — CID 9778
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane (PubChem CID 9778) has the molecular formula C7HF15 and a molecular weight of 370.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane |
|---|---|
| PubChem CID | 9778 |
| Molecular Formula | C7HF15 |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF15/c8-1(9)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)22/h1H |
| InChIKey | HBZVXKDQRIQMCW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|