About 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide
5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 977963) has the molecular formula C9H6BrClN4O
and a molecular weight of 301.53 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 977963 |
| Molecular Formula | C9H6BrClN4O |
| Molecular Weight | 301.53 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(Nn1cnnc1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C9H6BrClN4O/c10-6-1-2-8(11)7(3-6)9(16)14-15-4-12-13-5-15/h1-5H,(H,14,16) |
| InChIKey | CBMDNNDAISSFLV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide (CID 977963) is 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide is O=C(Nn1cnnc1)c1cc(Br)ccc1Cl.
What is the InChIKey of 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is CBMDNNDAISSFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClN4O/c10-6-1-2-8(11)7(3-6)9(16)14-15-4-12-13-5-15/h1-5H,(H,14,16).
What are the key properties of 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide?
5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 301.53 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-N-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 977963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).