C17H17N3OS — CID 978233
3-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 978233) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 978233 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(C)c1OCc1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C17H17N3OS/c1-12-7-6-8-13(2)16(12)21-11-15-18-19-17(22)20(15)14-9-4-3-5-10-14/h3-10H,11H2,1-2H3,(H,19,22) |
| InChIKey | LWXUOBXLPCBGRG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|