C24H22N2O4S — CID 979779
N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 979779) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 979779 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(-c3nc4ccccc4s3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N2O4S/c1-28-19-12-17(13-20(29-2)22(19)30-3)23(27)25-14-15-8-10-16(11-9-15)24-26-18-6-4-5-7-21(18)31-24/h4-13H,14H2,1-3H3,(H,25,27) |
| InChIKey | ZSYWSWNAVLCUEA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |