About 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile
2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile (PubChem CID 979890) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile |
| PubChem CID | 979890 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile |
| SMILES | CCOc1nc(-c2ccc(OC)cc2)cc(-c2ccc(OC)cc2)c1C#N |
| InChI | InChI=1S/C22H20N2O3/c1-4-27-22-20(14-23)19(15-5-9-17(25-2)10-6-15)13-21(24-22)16-7-11-18(26-3)12-8-16/h5-13H,4H2,1-3H3 |
| InChIKey | ATOJCHALHPVRIR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The IUPAC name of 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile (CID 979890) is 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The canonical SMILES for 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile is CCOc1nc(-c2ccc(OC)cc2)cc(-c2ccc(OC)cc2)c1C#N.
What is the InChIKey of 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The InChIKey is ATOJCHALHPVRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-4-27-22-20(14-23)19(15-5-9-17(25-2)10-6-15)13-21(24-22)16-7-11-18(26-3)12-8-16/h5-13H,4H2,1-3H3.
What are the key properties of 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile has a molecular weight of 360.41 g/mol, XLogP of 4.70, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile is sourced from PubChem (CID 979890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).