About methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate
methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate (PubChem CID 98006332) has the molecular formula C12H13Cl2NO3
and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate |
| PubChem CID | 98006332 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](Oc2cc(Cl)ccc2Cl)CN1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-17-12(16)10-5-8(6-15-10)18-11-4-7(13)2-3-9(11)14/h2-4,8,10,15H,5-6H2,1H3/t8-,10-/m1/s1 |
| InChIKey | UQVUZQDLRPNENB-PSASIEDQSA-N |
| XLogP | 2.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate?
The IUPAC name of methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate (CID 98006332) is methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate is COC(=O)[C@H]1C[C@@H](Oc2cc(Cl)ccc2Cl)CN1.
What is the InChIKey of methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate?
The InChIKey is UQVUZQDLRPNENB-PSASIEDQSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-17-12(16)10-5-8(6-15-10)18-11-4-7(13)2-3-9(11)14/h2-4,8,10,15H,5-6H2,1H3/t8-,10-/m1/s1.
What are the key properties of methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate?
methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate has a molecular weight of 290.15 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4R)-4-(2,5-dichlorophenoxy)pyrrolidine-2-carboxylate is sourced from PubChem (CID 98006332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).