C13H20N2O7S3 — CID 98009056
methyl N-[[(4R)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]ethanimidate (PubChem CID 98009056) has the molecular formula C13H20N2O7S3 and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl N-[[(4R)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]ethanimidate.
| Compound Name | methyl N-[[(4R)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]ethanimidate |
|---|---|
| PubChem CID | 98009056 |
| Molecular Formula | C13H20N2O7S3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | methyl N-[[(4R)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]ethanimidate |
| SMILES | COCCCN1C[C@H](O)c2cc(S(=O)(=O)N=C(C)OC)sc2S1(=O)=O |
| InChI | InChI=1S/C13H20N2O7S3/c1-9(22-3)14-24(17,18)12-7-10-11(16)8-15(5-4-6-21-2)25(19,20)13(10)23-12/h7,11,16H,4-6,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | NGMFMGBINCLKCA-NSHDSACASA-N |
| XLogP | 0.58 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|