About tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate
tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate (PubChem CID 98010166) has the molecular formula C10H18F2N2O2
and a molecular weight of 236.26 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate |
| PubChem CID | 98010166 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)[C@@H](N)C1 |
| InChI | InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-5-4-10(11,12)7(13)6-14/h7H,4-6,13H2,1-3H3/t7-/m0/s1 |
| InChIKey | QQCPPJQFZYGBHZ-ZETCQYMHSA-N |
| XLogP | 1.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate (CID 98010166) is tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(F)(F)[C@@H](N)C1.
What is the InChIKey of tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate?
The InChIKey is QQCPPJQFZYGBHZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-5-4-10(11,12)7(13)6-14/h7H,4-6,13H2,1-3H3/t7-/m0/s1.
What are the key properties of tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate?
tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate has a molecular weight of 236.26 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-amino-4,4-difluoropiperidine-1-carboxylate is sourced from PubChem (CID 98010166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).