C11H18N4O2 — CID 98013250
1-methyl-3-[methyl-[[(2S)-morpholin-2-yl]methyl]amino]pyrazin-2-one (PubChem CID 98013250) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-methyl-3-[methyl-[[(2S)-morpholin-2-yl]methyl]amino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[methyl-[[(2S)-morpholin-2-yl]methyl]amino]pyrazin-2-one |
|---|---|
| PubChem CID | 98013250 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-methyl-3-[methyl-[[(2S)-morpholin-2-yl]methyl]amino]pyrazin-2-one |
| SMILES | CN(C[C@@H]1CNCCO1)c1nccn(C)c1=O |
| InChI | InChI=1S/C11H18N4O2/c1-14-5-3-13-10(11(14)16)15(2)8-9-7-12-4-6-17-9/h3,5,9,12H,4,6-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | QYLIORDKXKKBFM-VIFPVBQESA-N |
| XLogP | -0.80 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |