C14H19NO4 — CID 98017762
2-[methyl-[2-(4-propan-2-yloxyphenyl)acetyl]amino]acetic acid (PubChem CID 98017762) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[methyl-[2-(4-propan-2-yloxyphenyl)acetyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(4-propan-2-yloxyphenyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 98017762 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-[methyl-[2-(4-propan-2-yloxyphenyl)acetyl]amino]acetic acid |
| SMILES | CC(C)Oc1ccc(CC(=O)N(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-10(2)19-12-6-4-11(5-7-12)8-13(16)15(3)9-14(17)18/h4-7,10H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | LAOCPPNKVQUWII-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |