C12H12FN5S — CID 98020805
2-fluoro-5-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]aniline (PubChem CID 98020805) has the molecular formula C12H12FN5S and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-fluoro-5-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]aniline.
| Compound Name | 2-fluoro-5-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]aniline |
|---|---|
| PubChem CID | 98020805 |
| Molecular Formula | C12H12FN5S |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-fluoro-5-[2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]aniline |
| SMILES | Cc1nnc2sc(CCc3ccc(F)c(N)c3)nn12 |
| InChI | InChI=1S/C12H12FN5S/c1-7-15-16-12-18(7)17-11(19-12)5-3-8-2-4-9(13)10(14)6-8/h2,4,6H,3,5,14H2,1H3 |
| InChIKey | OQZZPXXCZGLBFK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|